C23H34N2 — CID 144788071
4-[(3Z,5Z)-hepta-3,5-dien-2-yl]-6-methyl-2-phenyl-1,4-dihydropyrimidine;2-methylbutane (PubChem CID 144788071) has the molecular formula C23H34N2 and a molecular weight of 338.54 g/mol. Its IUPAC name is 4-[(3Z,5Z)-hepta-3,5-dien-2-yl]-6-methyl-2-phenyl-1,4-dihydropyrimidine;2-methylbutane.
| Compound Name | 4-[(3Z,5Z)-hepta-3,5-dien-2-yl]-6-methyl-2-phenyl-1,4-dihydropyrimidine;2-methylbutane |
|---|---|
| PubChem CID | 144788071 |
| Molecular Formula | C23H34N2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | 4-[(3Z,5Z)-hepta-3,5-dien-2-yl]-6-methyl-2-phenyl-1,4-dihydropyrimidine;2-methylbutane |
| SMILES | C/C=C\C=C/C(C)C1C=C(C)NC(c2ccccc2)=N1.CCC(C)C |
| InChI | InChI=1S/C18H22N2.C5H12/c1-4-5-7-10-14(2)17-13-15(3)19-18(20-17)16-11-8-6-9-12-16;1-4-5(2)3/h4-14,17H,1-3H3,(H,19,20);5H,4H2,1-3H3/b5-4-,10-7-; |
| InChIKey | XWXAWJQWXDCHOL-ZZJONCOJSA-N |
| XLogP | 6.13 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|