C5H10FN3 — CID 144791046
5-(2-fluoroethyl)-3-methyl-1,2-dihydrotriazole (PubChem CID 144791046) has the molecular formula C5H10FN3 and a molecular weight of 131.15 g/mol. Its IUPAC name is 5-(2-fluoroethyl)-3-methyl-1,2-dihydrotriazole.
| Compound Name | 5-(2-fluoroethyl)-3-methyl-1,2-dihydrotriazole |
|---|---|
| PubChem CID | 144791046 |
| Molecular Formula | C5H10FN3 |
| Molecular Weight | 131.15 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | 5-(2-fluoroethyl)-3-methyl-1,2-dihydrotriazole |
| SMILES | CN1C=C(CCF)NN1 |
| InChI | InChI=1S/C5H10FN3/c1-9-4-5(2-3-6)7-8-9/h4,7-8H,2-3H2,1H3 |
| InChIKey | AGRAYDBUZLRKEG-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.15 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |