C19H17ClN6S — CID 144791652
8-(3-chloro-5-methylphenyl)sulfanyl-9-(2-pyridin-3-ylethyl)purin-6-amine (PubChem CID 144791652) has the molecular formula C19H17ClN6S and a molecular weight of 396.91 g/mol. Its IUPAC name is 8-(3-chloro-5-methylphenyl)sulfanyl-9-(2-pyridin-3-ylethyl)purin-6-amine.
| Compound Name | 8-(3-chloro-5-methylphenyl)sulfanyl-9-(2-pyridin-3-ylethyl)purin-6-amine |
|---|---|
| PubChem CID | 144791652 |
| Molecular Formula | C19H17ClN6S |
| Molecular Weight | 396.91 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 8-(3-chloro-5-methylphenyl)sulfanyl-9-(2-pyridin-3-ylethyl)purin-6-amine |
| SMILES | Cc1cc(Cl)cc(Sc2nc3c(N)ncnc3n2CCc2cccnc2)c1 |
| InChI | InChI=1S/C19H17ClN6S/c1-12-7-14(20)9-15(8-12)27-19-25-16-17(21)23-11-24-18(16)26(19)6-4-13-3-2-5-22-10-13/h2-3,5,7-11H,4,6H2,1H3,(H2,21,23,24) |
| InChIKey | JTGCFLSOXOHXTB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.91 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |