C18H23BrN2O4S2 — CID 144791760
4-(5-bromothiophen-2-yl)-N-[3-hydroxy-4-(hydroxyamino)-3-methylsulfanyl-4-oxobutyl]benzamide;ethane (PubChem CID 144791760) has the molecular formula C18H23BrN2O4S2 and a molecular weight of 475.43 g/mol. Its IUPAC name is 4-(5-bromothiophen-2-yl)-N-[3-hydroxy-4-(hydroxyamino)-3-methylsulfanyl-4-oxobutyl]benzamide;ethane.
| Compound Name | 4-(5-bromothiophen-2-yl)-N-[3-hydroxy-4-(hydroxyamino)-3-methylsulfanyl-4-oxobutyl]benzamide;ethane |
|---|---|
| PubChem CID | 144791760 |
| Molecular Formula | C18H23BrN2O4S2 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | 4-(5-bromothiophen-2-yl)-N-[3-hydroxy-4-(hydroxyamino)-3-methylsulfanyl-4-oxobutyl]benzamide;ethane |
| SMILES | CC.CSC(O)(CCNC(=O)c1ccc(-c2ccc(Br)s2)cc1)C(=O)NO |
| InChI | InChI=1S/C16H17BrN2O4S2.C2H6/c1-24-16(22,15(21)19-23)8-9-18-14(20)11-4-2-10(3-5-11)12-6-7-13(17)25-12;1-2/h2-7,22-23H,8-9H2,1H3,(H,18,20)(H,19,21);1-2H3 |
| InChIKey | SYDXTPJRLIQEKP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|