C13H12BrNOS — CID 59723637
4-(5-bromothiophen-2-yl)-N,N-dimethylbenzamide (PubChem CID 59723637) has the molecular formula C13H12BrNOS and a molecular weight of 310.22 g/mol. Its IUPAC name is 4-(5-bromothiophen-2-yl)-N,N-dimethylbenzamide.
| Compound Name | 4-(5-bromothiophen-2-yl)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 59723637 |
| Molecular Formula | C13H12BrNOS |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 4-(5-bromothiophen-2-yl)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(-c2ccc(Br)s2)cc1 |
| InChI | InChI=1S/C13H12BrNOS/c1-15(2)13(16)10-5-3-9(4-6-10)11-7-8-12(14)17-11/h3-8H,1-2H3 |
| InChIKey | QUSZQTKCRWUCTP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |