C14H14N2O2 — CID 53218069
N,N-dimethyl-4-(6-oxo-1H-pyridin-3-yl)benzamide (PubChem CID 53218069) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is N,N-dimethyl-4-(6-oxo-1H-pyridin-3-yl)benzamide.
| Compound Name | N,N-dimethyl-4-(6-oxo-1H-pyridin-3-yl)benzamide |
|---|---|
| PubChem CID | 53218069 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N,N-dimethyl-4-(6-oxo-1H-pyridin-3-yl)benzamide |
| SMILES | CN(C)C(=O)c1ccc(-c2ccc(=O)[nH]c2)cc1 |
| InChI | InChI=1S/C14H14N2O2/c1-16(2)14(18)11-5-3-10(4-6-11)12-7-8-13(17)15-9-12/h3-9H,1-2H3,(H,15,17) |
| InChIKey | UPFLWGQWZJRNRY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |