About 4-(2,4-dioxo-1H-pyrimidin-5-yl)-N,N-dimethylbenzamide
4-(2,4-dioxo-1H-pyrimidin-5-yl)-N,N-dimethylbenzamide (PubChem CID 53222393) has the molecular formula C13H13N3O3
and a molecular weight of 259.26 g/mol. Its IUPAC name is 4-(2,4-dioxo-1H-pyrimidin-5-yl)-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 4-(2,4-dioxo-1H-pyrimidin-5-yl)-N,N-dimethylbenzamide |
| PubChem CID | 53222393 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 4-(2,4-dioxo-1H-pyrimidin-5-yl)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(-c2c[nH]c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C13H13N3O3/c1-16(2)12(18)9-5-3-8(4-6-9)10-7-14-13(19)15-11(10)17/h3-7H,1-2H3,(H2,14,15,17,19) |
| InChIKey | AJXDICCIRZOFBH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,4-dioxo-1H-pyrimidin-5-yl)-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dioxo-1H-pyrimidin-5-yl)-N,N-dimethylbenzamide?
The IUPAC name of 4-(2,4-dioxo-1H-pyrimidin-5-yl)-N,N-dimethylbenzamide (CID 53222393) is 4-(2,4-dioxo-1H-pyrimidin-5-yl)-N,N-dimethylbenzamide.
What is the SMILES notation for 4-(2,4-dioxo-1H-pyrimidin-5-yl)-N,N-dimethylbenzamide?
The canonical SMILES for 4-(2,4-dioxo-1H-pyrimidin-5-yl)-N,N-dimethylbenzamide is CN(C)C(=O)c1ccc(-c2c[nH]c(=O)[nH]c2=O)cc1.
What is the InChIKey of 4-(2,4-dioxo-1H-pyrimidin-5-yl)-N,N-dimethylbenzamide?
The InChIKey is AJXDICCIRZOFBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O3/c1-16(2)12(18)9-5-3-8(4-6-9)10-7-14-13(19)15-11(10)17/h3-7H,1-2H3,(H2,14,15,17,19).
What are the key properties of 4-(2,4-dioxo-1H-pyrimidin-5-yl)-N,N-dimethylbenzamide?
4-(2,4-dioxo-1H-pyrimidin-5-yl)-N,N-dimethylbenzamide has a molecular weight of 259.26 g/mol, XLogP of 0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dioxo-1H-pyrimidin-5-yl)-N,N-dimethylbenzamide is sourced from PubChem (CID 53222393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).