C10H16N2O3 — CID 144793419
2-(2-amino-5-hydroxy-4,4-dimethylcyclohexen-1-yl)-2-iminoacetic acid (PubChem CID 144793419) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-(2-amino-5-hydroxy-4,4-dimethylcyclohexen-1-yl)-2-iminoacetic acid.
| Compound Name | 2-(2-amino-5-hydroxy-4,4-dimethylcyclohexen-1-yl)-2-iminoacetic acid |
|---|---|
| PubChem CID | 144793419 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-(2-amino-5-hydroxy-4,4-dimethylcyclohexen-1-yl)-2-iminoacetic acid |
| SMILES | [H]/N=C(\C(=O)O)C1=C(N)CC(C)(C)C(O)C1 |
| InChI | InChI=1S/C10H16N2O3/c1-10(2)4-6(11)5(3-7(10)13)8(12)9(14)15/h7,12-13H,3-4,11H2,1-2H3,(H,14,15)/b12-8- |
| InChIKey | AOTIWQBVRLJBQL-WQLSENKSSA-N |
| XLogP | 0.48 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|