C11H20N2O2 — CID 166112954
2-(2-amino-4,4-dimethylcyclohexen-1-yl)-2-iminoacetaldehyde;methanol (PubChem CID 166112954) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-(2-amino-4,4-dimethylcyclohexen-1-yl)-2-iminoacetaldehyde;methanol.
| Compound Name | 2-(2-amino-4,4-dimethylcyclohexen-1-yl)-2-iminoacetaldehyde;methanol |
|---|---|
| PubChem CID | 166112954 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 2-(2-amino-4,4-dimethylcyclohexen-1-yl)-2-iminoacetaldehyde;methanol |
| SMILES | CO.[H]/N=C(\C=O)C1=C(N)CC(C)(C)CC1 |
| InChI | InChI=1S/C10H16N2O.CH4O/c1-10(2)4-3-7(8(11)5-10)9(12)6-13;1-2/h6,12H,3-5,11H2,1-2H3;2H,1H3/b12-9+; |
| InChIKey | ZDXQBSIJQDPHGU-NBYYMMLRSA-N |
| XLogP | 1.24 |
| TPSA | 87.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|