C27H30N4O4 — CID 144793898
ethane;ethyl 6-(3-ethynylphenyl)-4-pyrazin-2-ylpyridine-2-carboxylate;3-hydroxy-1-methylpyrrolidin-2-one (PubChem CID 144793898) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is ethane;ethyl 6-(3-ethynylphenyl)-4-pyrazin-2-ylpyridine-2-carboxylate;3-hydroxy-1-methylpyrrolidin-2-one.
| Compound Name | ethane;ethyl 6-(3-ethynylphenyl)-4-pyrazin-2-ylpyridine-2-carboxylate;3-hydroxy-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 144793898 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | ethane;ethyl 6-(3-ethynylphenyl)-4-pyrazin-2-ylpyridine-2-carboxylate;3-hydroxy-1-methylpyrrolidin-2-one |
| SMILES | C#Cc1cccc(-c2cc(-c3cnccn3)cc(C(=O)OCC)n2)c1.CC.CN1CCC(O)C1=O |
| InChI | InChI=1S/C20H15N3O2.C5H9NO2.C2H6/c1-3-14-6-5-7-15(10-14)17-11-16(19-13-21-8-9-22-19)12-18(23-17)20(24)25-4-2;1-6-3-2-4(7)5(6)8;1-2/h1,5-13H,4H2,2H3;4,7H,2-3H2,1H3;1-2H3 |
| InChIKey | JBCSPZHRVHOZMO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|