C18H19ClN3S+ — CID 144794166
5-[3-(2-chlorophenyl)-1-methylpyridin-1-ium-4-yl]-N-propyl-1,3-thiazol-2-amine (PubChem CID 144794166) has the molecular formula C18H19ClN3S+ and a molecular weight of 344.89 g/mol. Its IUPAC name is 5-[3-(2-chlorophenyl)-1-methylpyridin-1-ium-4-yl]-N-propyl-1,3-thiazol-2-amine.
| Compound Name | 5-[3-(2-chlorophenyl)-1-methylpyridin-1-ium-4-yl]-N-propyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 144794166 |
| Molecular Formula | C18H19ClN3S+ |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 5-[3-(2-chlorophenyl)-1-methylpyridin-1-ium-4-yl]-N-propyl-1,3-thiazol-2-amine |
| SMILES | CCCNc1ncc(-c2cc[n+](C)cc2-c2ccccc2Cl)s1 |
| InChI | InChI=1S/C18H18ClN3S/c1-3-9-20-18-21-11-17(23-18)14-8-10-22(2)12-15(14)13-6-4-5-7-16(13)19/h4-8,10-12H,3,9H2,1-2H3/p+1 |
| InChIKey | NOYJYMCPIFBBTA-UHFFFAOYSA-O |
| XLogP | 4.78 |
| TPSA | 28.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|