C17H17ClN2OS — CID 143047554
4-[[5-(2-chlorophenyl)-1,3-thiazol-2-yl]amino]phenol;ethane (PubChem CID 143047554) has the molecular formula C17H17ClN2OS and a molecular weight of 332.86 g/mol. Its IUPAC name is 4-[[5-(2-chlorophenyl)-1,3-thiazol-2-yl]amino]phenol;ethane.
| Compound Name | 4-[[5-(2-chlorophenyl)-1,3-thiazol-2-yl]amino]phenol;ethane |
|---|---|
| PubChem CID | 143047554 |
| Molecular Formula | C17H17ClN2OS |
| Molecular Weight | 332.86 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 4-[[5-(2-chlorophenyl)-1,3-thiazol-2-yl]amino]phenol;ethane |
| SMILES | CC.Oc1ccc(Nc2ncc(-c3ccccc3Cl)s2)cc1 |
| InChI | InChI=1S/C15H11ClN2OS.C2H6/c16-13-4-2-1-3-12(13)14-9-17-15(20-14)18-10-5-7-11(19)8-6-10;1-2/h1-9,19H,(H,17,18);1-2H3 |
| InChIKey | SMOUPVNGFQTPQG-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.86 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|