C23H26N4O2 — CID 144796932
formamide;[2-[3-(6-pyrrolidin-1-yl-2-pyridinyl)anilino]phenyl]methanol (PubChem CID 144796932) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is formamide;[2-[3-(6-pyrrolidin-1-yl-2-pyridinyl)anilino]phenyl]methanol.
| Compound Name | formamide;[2-[3-(6-pyrrolidin-1-yl-2-pyridinyl)anilino]phenyl]methanol |
|---|---|
| PubChem CID | 144796932 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | formamide;[2-[3-(6-pyrrolidin-1-yl-2-pyridinyl)anilino]phenyl]methanol |
| SMILES | NC=O.OCc1ccccc1Nc1cccc(-c2cccc(N3CCCC3)n2)c1 |
| InChI | InChI=1S/C22H23N3O.CH3NO/c26-16-18-7-1-2-10-21(18)23-19-9-5-8-17(15-19)20-11-6-12-22(24-20)25-13-3-4-14-25;2-1-3/h1-2,5-12,15,23,26H,3-4,13-14,16H2;1H,(H2,2,3) |
| InChIKey | WPLGCCKFSKKEQF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|