C24H26N4O — CID 118716120
1-(2,6-dimethylphenyl)-3-[3-(6-pyrrolidin-1-yl-2-pyridinyl)phenyl]urea (PubChem CID 118716120) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[3-(6-pyrrolidin-1-yl-2-pyridinyl)phenyl]urea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[3-(6-pyrrolidin-1-yl-2-pyridinyl)phenyl]urea |
|---|---|
| PubChem CID | 118716120 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[3-(6-pyrrolidin-1-yl-2-pyridinyl)phenyl]urea |
| SMILES | Cc1cccc(C)c1NC(=O)Nc1cccc(-c2cccc(N3CCCC3)n2)c1 |
| InChI | InChI=1S/C24H26N4O/c1-17-8-5-9-18(2)23(17)27-24(29)25-20-11-6-10-19(16-20)21-12-7-13-22(26-21)28-14-3-4-15-28/h5-13,16H,3-4,14-15H2,1-2H3,(H2,25,27,29) |
| InChIKey | GBDFKMAHKDXCIN-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |