C25H34N4O6S — CID 144798015
S-[(E)-4-[(4Z,7S,10S)-4-ethylidene-8-hydroxy-2,5,12-trioxo-7-propan-2-yl-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] ethanethioate (PubChem CID 144798015) has the molecular formula C25H34N4O6S and a molecular weight of 518.64 g/mol. Its IUPAC name is S-[(E)-4-[(4Z,7S,10S)-4-ethylidene-8-hydroxy-2,5,12-trioxo-7-propan-2-yl-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] ethanethioate.
| Compound Name | S-[(E)-4-[(4Z,7S,10S)-4-ethylidene-8-hydroxy-2,5,12-trioxo-7-propan-2-yl-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 144798015 |
| Molecular Formula | C25H34N4O6S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | S-[(E)-4-[(4Z,7S,10S)-4-ethylidene-8-hydroxy-2,5,12-trioxo-7-propan-2-yl-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-10-yl]but-3-enyl] ethanethioate |
| SMILES | C/C=C1\NC(=O)c2cccc(n2)CNC(=O)C[C@@H](/C=C/CCSC(C)=O)OC(O)[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C25H34N4O6S/c1-5-19-23(32)29-22(15(2)3)25(34)35-18(10-6-7-12-36-16(4)30)13-21(31)26-14-17-9-8-11-20(27-17)24(33)28-19/h5-6,8-11,15,18,22,25,34H,7,12-14H2,1-4H3,(H,26,31)(H,28,33)(H,29,32)/b10-6+,19-5-/t18-,22+,25?/m1/s1 |
| InChIKey | XLCTVULQYRWTGD-ZCFMAGFDSA-N |
| XLogP | 1.81 |
| TPSA | 146.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|