C20H16F2N2O2 — CID 144798905
(E)-1-(2-fluoro-4-methoxyphenyl)-3-[3-(4-fluoro-3-methylphenyl)-1H-pyrazol-5-yl]prop-2-en-1-one (PubChem CID 144798905) has the molecular formula C20H16F2N2O2 and a molecular weight of 354.36 g/mol. Its IUPAC name is (E)-1-(2-fluoro-4-methoxyphenyl)-3-[3-(4-fluoro-3-methylphenyl)-1H-pyrazol-5-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(2-fluoro-4-methoxyphenyl)-3-[3-(4-fluoro-3-methylphenyl)-1H-pyrazol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 144798905 |
| Molecular Formula | C20H16F2N2O2 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (E)-1-(2-fluoro-4-methoxyphenyl)-3-[3-(4-fluoro-3-methylphenyl)-1H-pyrazol-5-yl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2cc(-c3ccc(F)c(C)c3)n[nH]2)c(F)c1 |
| InChI | InChI=1S/C20H16F2N2O2/c1-12-9-13(3-7-17(12)21)19-10-14(23-24-19)4-8-20(25)16-6-5-15(26-2)11-18(16)22/h3-11H,1-2H3,(H,23,24)/b8-4+ |
| InChIKey | FFWFEHORTTYQDI-XBXARRHUSA-N |
| XLogP | 4.57 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|