C19H14ClFN2O — CID 122414135
(E)-3-[3-(4-chlorophenyl)-1H-pyrazol-5-yl]-1-(4-fluoro-3-methylphenyl)prop-2-en-1-one (PubChem CID 122414135) has the molecular formula C19H14ClFN2O and a molecular weight of 340.79 g/mol. Its IUPAC name is (E)-3-[3-(4-chlorophenyl)-1H-pyrazol-5-yl]-1-(4-fluoro-3-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-(4-chlorophenyl)-1H-pyrazol-5-yl]-1-(4-fluoro-3-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 122414135 |
| Molecular Formula | C19H14ClFN2O |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | (E)-3-[3-(4-chlorophenyl)-1H-pyrazol-5-yl]-1-(4-fluoro-3-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1cc(C(=O)/C=C/c2cc(-c3ccc(Cl)cc3)n[nH]2)ccc1F |
| InChI | InChI=1S/C19H14ClFN2O/c1-12-10-14(4-8-17(12)21)19(24)9-7-16-11-18(23-22-16)13-2-5-15(20)6-3-13/h2-11H,1H3,(H,22,23)/b9-7+ |
| InChIKey | QOADCNNAYLMJBJ-VQHVLOKHSA-N |
| XLogP | 5.07 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|