C21H19ClN2O3 — CID 122414123
(E)-3-[3-[3,4-bis(hydroxymethyl)phenyl]-1H-pyrazol-5-yl]-1-(4-chloro-3-methylphenyl)prop-2-en-1-one (PubChem CID 122414123) has the molecular formula C21H19ClN2O3 and a molecular weight of 382.85 g/mol. Its IUPAC name is (E)-3-[3-[3,4-bis(hydroxymethyl)phenyl]-1H-pyrazol-5-yl]-1-(4-chloro-3-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[3,4-bis(hydroxymethyl)phenyl]-1H-pyrazol-5-yl]-1-(4-chloro-3-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 122414123 |
| Molecular Formula | C21H19ClN2O3 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | (E)-3-[3-[3,4-bis(hydroxymethyl)phenyl]-1H-pyrazol-5-yl]-1-(4-chloro-3-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1cc(C(=O)/C=C/c2cc(-c3ccc(CO)c(CO)c3)n[nH]2)ccc1Cl |
| InChI | InChI=1S/C21H19ClN2O3/c1-13-8-15(4-6-19(13)22)21(27)7-5-18-10-20(24-23-18)14-2-3-16(11-25)17(9-14)12-26/h2-10,25-26H,11-12H2,1H3,(H,23,24)/b7-5+ |
| InChIKey | GHBMUBDTENMYQI-FNORWQNLSA-N |
| XLogP | 3.92 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|