C19H12Cl2N2O3 — CID 123340049
3-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-1-(3,4-dichlorophenyl)prop-2-en-1-one (PubChem CID 123340049) has the molecular formula C19H12Cl2N2O3 and a molecular weight of 387.22 g/mol. Its IUPAC name is 3-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-1-(3,4-dichlorophenyl)prop-2-en-1-one.
| Compound Name | 3-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-1-(3,4-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 123340049 |
| Molecular Formula | C19H12Cl2N2O3 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 3-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-1-(3,4-dichlorophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1cc(-c2ccc3c(c2)OCO3)n[nH]1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H12Cl2N2O3/c20-14-4-1-12(7-15(14)21)17(24)5-3-13-9-16(23-22-13)11-2-6-18-19(8-11)26-10-25-18/h1-9H,10H2,(H,22,23) |
| InChIKey | CRYRWCCDGROMEK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|