C19H14N2O3 — CID 123331276
1-(1,3-benzodioxol-5-yl)-3-(3-phenyl-1H-pyrazol-5-yl)prop-2-en-1-one (PubChem CID 123331276) has the molecular formula C19H14N2O3 and a molecular weight of 318.33 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(3-phenyl-1H-pyrazol-5-yl)prop-2-en-1-one.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(3-phenyl-1H-pyrazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 123331276 |
| Molecular Formula | C19H14N2O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(3-phenyl-1H-pyrazol-5-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1cc(-c2ccccc2)n[nH]1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H14N2O3/c22-17(14-6-9-18-19(10-14)24-12-23-18)8-7-15-11-16(21-20-15)13-4-2-1-3-5-13/h1-11H,12H2,(H,20,21) |
| InChIKey | NNWFEZHPZIDSNY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|