C20H17ClN2O2 — CID 122414119
(E)-1-(4-chloro-3-methylphenyl)-3-[3-[4-(hydroxymethyl)phenyl]-1H-pyrazol-5-yl]prop-2-en-1-one (PubChem CID 122414119) has the molecular formula C20H17ClN2O2 and a molecular weight of 352.82 g/mol. Its IUPAC name is (E)-1-(4-chloro-3-methylphenyl)-3-[3-[4-(hydroxymethyl)phenyl]-1H-pyrazol-5-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-chloro-3-methylphenyl)-3-[3-[4-(hydroxymethyl)phenyl]-1H-pyrazol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122414119 |
| Molecular Formula | C20H17ClN2O2 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | (E)-1-(4-chloro-3-methylphenyl)-3-[3-[4-(hydroxymethyl)phenyl]-1H-pyrazol-5-yl]prop-2-en-1-one |
| SMILES | Cc1cc(C(=O)/C=C/c2cc(-c3ccc(CO)cc3)n[nH]2)ccc1Cl |
| InChI | InChI=1S/C20H17ClN2O2/c1-13-10-16(6-8-18(13)21)20(25)9-7-17-11-19(23-22-17)15-4-2-14(12-24)3-5-15/h2-11,24H,12H2,1H3,(H,22,23)/b9-7+ |
| InChIKey | XVFSGCVMLIKPBE-VQHVLOKHSA-N |
| XLogP | 4.43 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|