C22H24N2O3 — CID 144798833
ethane;(E)-1-(3-hydroxy-4-methoxyphenyl)-3-[3-(4-methylphenyl)-1H-pyrazol-5-yl]prop-2-en-1-one (PubChem CID 144798833) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is ethane;(E)-1-(3-hydroxy-4-methoxyphenyl)-3-[3-(4-methylphenyl)-1H-pyrazol-5-yl]prop-2-en-1-one.
| Compound Name | ethane;(E)-1-(3-hydroxy-4-methoxyphenyl)-3-[3-(4-methylphenyl)-1H-pyrazol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 144798833 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | ethane;(E)-1-(3-hydroxy-4-methoxyphenyl)-3-[3-(4-methylphenyl)-1H-pyrazol-5-yl]prop-2-en-1-one |
| SMILES | CC.COc1ccc(C(=O)/C=C/c2cc(-c3ccc(C)cc3)n[nH]2)cc1O |
| InChI | InChI=1S/C20H18N2O3.C2H6/c1-13-3-5-14(6-4-13)17-12-16(21-22-17)8-9-18(23)15-7-10-20(25-2)19(24)11-15;1-2/h3-12,24H,1-2H3,(H,21,22);1-2H3/b9-8+; |
| InChIKey | BJZSNDOQLDKLDV-HRNDJLQDSA-N |
| XLogP | 5.02 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|