C5H7ClN2 — CID 144800062
3-chloro-1,2-dihydropyridin-6-amine (PubChem CID 144800062) has the molecular formula C5H7ClN2 and a molecular weight of 130.58 g/mol. Its IUPAC name is 3-chloro-1,2-dihydropyridin-6-amine.
| Compound Name | 3-chloro-1,2-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 144800062 |
| Molecular Formula | C5H7ClN2 |
| Molecular Weight | 130.58 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | 3-chloro-1,2-dihydropyridin-6-amine |
| SMILES | NC1=CC=C(Cl)CN1 |
| InChI | InChI=1S/C5H7ClN2/c6-4-1-2-5(7)8-3-4/h1-2,8H,3,7H2 |
| InChIKey | XPOIEOHVAVVCTJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.58 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |