C24H15ClF6N2OS2 — CID 144801034
3-chloro-4-[2-[3-phenylmethoxy-4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]-N-(trifluoromethylsulfanyl)aniline (PubChem CID 144801034) has the molecular formula C24H15ClF6N2OS2 and a molecular weight of 560.97 g/mol. Its IUPAC name is 3-chloro-4-[2-[3-phenylmethoxy-4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]-N-(trifluoromethylsulfanyl)aniline.
| Compound Name | 3-chloro-4-[2-[3-phenylmethoxy-4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]-N-(trifluoromethylsulfanyl)aniline |
|---|---|
| PubChem CID | 144801034 |
| Molecular Formula | C24H15ClF6N2OS2 |
| Molecular Weight | 560.97 g/mol |
| Exact Mass | 560.02 |
| IUPAC Name | 3-chloro-4-[2-[3-phenylmethoxy-4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]-N-(trifluoromethylsulfanyl)aniline |
| SMILES | FC(F)(F)SNc1ccc(-c2csc(-c3ccc(C(F)(F)F)c(OCc4ccccc4)c3)n2)c(Cl)c1 |
| InChI | InChI=1S/C24H15ClF6N2OS2/c25-19-11-16(33-36-24(29,30)31)7-8-17(19)20-13-35-22(32-20)15-6-9-18(23(26,27)28)21(10-15)34-12-14-4-2-1-3-5-14/h1-11,13,33H,12H2 |
| InChIKey | FDYURRQQGSFPGB-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.97 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|