C23H38N2S — CID 144805363
N'-[6-[(4Z)-2,6-dimethylocta-2,4-dien-7-yn-3-yl]sulfanylcyclohexa-1,3-dien-1-yl]-N-ethyl-N'-methylethane-1,2-diamine;ethane (PubChem CID 144805363) has the molecular formula C23H38N2S and a molecular weight of 374.64 g/mol. Its IUPAC name is N'-[6-[(4Z)-2,6-dimethylocta-2,4-dien-7-yn-3-yl]sulfanylcyclohexa-1,3-dien-1-yl]-N-ethyl-N'-methylethane-1,2-diamine;ethane.
| Compound Name | N'-[6-[(4Z)-2,6-dimethylocta-2,4-dien-7-yn-3-yl]sulfanylcyclohexa-1,3-dien-1-yl]-N-ethyl-N'-methylethane-1,2-diamine;ethane |
|---|---|
| PubChem CID | 144805363 |
| Molecular Formula | C23H38N2S |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | N'-[6-[(4Z)-2,6-dimethylocta-2,4-dien-7-yn-3-yl]sulfanylcyclohexa-1,3-dien-1-yl]-N-ethyl-N'-methylethane-1,2-diamine;ethane |
| SMILES | C#CC(C)/C=C\C(SC1CC=CC=C1N(C)CCNCC)=C(C)C.CC |
| InChI | InChI=1S/C21H32N2S.C2H6/c1-7-18(5)13-14-20(17(3)4)24-21-12-10-9-11-19(21)23(6)16-15-22-8-2;1-2/h1,9-11,13-14,18,21-22H,8,12,15-16H2,2-6H3;1-2H3/b14-13-; |
| InChIKey | UCBIVBBQBRGWSI-HPWRNOGASA-N |
| XLogP | 5.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|