C21H32N2S — CID 144805364
N'-[6-[(4Z)-2,6-dimethylocta-2,4-dien-7-yn-3-yl]sulfanylcyclohexa-1,3-dien-1-yl]-N-ethyl-N'-methylethane-1,2-diamine (PubChem CID 144805364) has the molecular formula C21H32N2S and a molecular weight of 344.57 g/mol. Its IUPAC name is N'-[6-[(4Z)-2,6-dimethylocta-2,4-dien-7-yn-3-yl]sulfanylcyclohexa-1,3-dien-1-yl]-N-ethyl-N'-methylethane-1,2-diamine.
| Compound Name | N'-[6-[(4Z)-2,6-dimethylocta-2,4-dien-7-yn-3-yl]sulfanylcyclohexa-1,3-dien-1-yl]-N-ethyl-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 144805364 |
| Molecular Formula | C21H32N2S |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | N'-[6-[(4Z)-2,6-dimethylocta-2,4-dien-7-yn-3-yl]sulfanylcyclohexa-1,3-dien-1-yl]-N-ethyl-N'-methylethane-1,2-diamine |
| SMILES | C#CC(C)/C=C\C(SC1CC=CC=C1N(C)CCNCC)=C(C)C |
| InChI | InChI=1S/C21H32N2S/c1-7-18(5)13-14-20(17(3)4)24-21-12-10-9-11-19(21)23(6)16-15-22-8-2/h1,9-11,13-14,18,21-22H,8,12,15-16H2,2-6H3/b14-13- |
| InChIKey | LAFYHDCEBJOAKC-YPKPFQOOSA-N |
| XLogP | 4.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|