C14H28N6O7 — CID 144805960
2-[[(2S)-6-amino-1-[2-[(2S)-2-amino-3-hydroxypropanoyl]hydrazinyl]-1-oxohexan-2-yl]carbamoylamino]-3-hydroxybutanoic acid (PubChem CID 144805960) has the molecular formula C14H28N6O7 and a molecular weight of 392.41 g/mol. Its IUPAC name is 2-[[(2S)-6-amino-1-[2-[(2S)-2-amino-3-hydroxypropanoyl]hydrazinyl]-1-oxohexan-2-yl]carbamoylamino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[(2S)-6-amino-1-[2-[(2S)-2-amino-3-hydroxypropanoyl]hydrazinyl]-1-oxohexan-2-yl]carbamoylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 144805960 |
| Molecular Formula | C14H28N6O7 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 2-[[(2S)-6-amino-1-[2-[(2S)-2-amino-3-hydroxypropanoyl]hydrazinyl]-1-oxohexan-2-yl]carbamoylamino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)N[C@@H](CCCCN)C(=O)NNC(=O)[C@@H](N)CO)C(=O)O |
| InChI | InChI=1S/C14H28N6O7/c1-7(22)10(13(25)26)18-14(27)17-9(4-2-3-5-15)12(24)20-19-11(23)8(16)6-21/h7-10,21-22H,2-6,15-16H2,1H3,(H,19,23)(H,20,24)(H,25,26)(H2,17,18,27)/t7?,8-,9-,10?/m0/s1 |
| InChIKey | LMOJVVYZEJEFOC-ZNHWEVIXSA-N |
| XLogP | -3.92 |
| TPSA | 229.13 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|