C9H13N3 — CID 144806472
1,2,3-trimethyl-3H-pyrazolo[3,4-b]pyridine (PubChem CID 144806472) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 1,2,3-trimethyl-3H-pyrazolo[3,4-b]pyridine.
| Compound Name | 1,2,3-trimethyl-3H-pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 144806472 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 1,2,3-trimethyl-3H-pyrazolo[3,4-b]pyridine |
| SMILES | CC1c2cccnc2N(C)N1C |
| InChI | InChI=1S/C9H13N3/c1-7-8-5-4-6-10-9(8)12(3)11(7)2/h4-7H,1-3H3 |
| InChIKey | ODWMFAPMLABEFV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |