C64H66 — CID 144810256
1,2-bis(ethenyl)-3,4,5-trimethyl-6-(4-methylphenyl)benzene;1-methyl-2-(2-methylphenyl)benzene;1-methyl-4-(4-methylphenyl)benzene;3,9,9-trimethylfluorene (PubChem CID 144810256) has the molecular formula C64H66 and a molecular weight of 835.23 g/mol. Its IUPAC name is 1,2-bis(ethenyl)-3,4,5-trimethyl-6-(4-methylphenyl)benzene;1-methyl-2-(2-methylphenyl)benzene;1-methyl-4-(4-methylphenyl)benzene;3,9,9-trimethylfluorene.
| Compound Name | 1,2-bis(ethenyl)-3,4,5-trimethyl-6-(4-methylphenyl)benzene;1-methyl-2-(2-methylphenyl)benzene;1-methyl-4-(4-methylphenyl)benzene;3,9,9-trimethylfluorene |
|---|---|
| PubChem CID | 144810256 |
| Molecular Formula | C64H66 |
| Molecular Weight | 835.23 g/mol |
| Exact Mass | 834.52 |
| IUPAC Name | 1,2-bis(ethenyl)-3,4,5-trimethyl-6-(4-methylphenyl)benzene;1-methyl-2-(2-methylphenyl)benzene;1-methyl-4-(4-methylphenyl)benzene;3,9,9-trimethylfluorene |
| SMILES | C=Cc1c(C)c(C)c(C)c(-c2ccc(C)cc2)c1C=C.Cc1ccc(-c2ccc(C)cc2)cc1.Cc1ccc2c(c1)-c1ccccc1C2(C)C.Cc1ccccc1-c1ccccc1C |
| InChI | InChI=1S/C20H22.C16H16.2C14H14/c1-7-18-15(5)14(4)16(6)20(19(18)8-2)17-11-9-13(3)10-12-17;1-11-8-9-15-13(10-11)12-6-4-5-7-14(12)16(15,2)3;1-11-3-7-13(8-4-11)14-9-5-12(2)6-10-14;1-11-7-3-5-9-13(11)14-10-6-4-8-12(14)2/h7-12H,1-2H2,3-6H3;4-10H,1-3H3;2*3-10H,1-2H3 |
| InChIKey | DIEQQELXPXNDFX-UHFFFAOYSA-N |
| XLogP | 18.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.23 |
| LogP ≤ 5 | 18.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |