C34H29Cl — CID 156827027
1-chloro-4-(4-phenylphenyl)benzene;3,9,9-trimethylfluorene (PubChem CID 156827027) has the molecular formula C34H29Cl and a molecular weight of 473.06 g/mol. Its IUPAC name is 1-chloro-4-(4-phenylphenyl)benzene;3,9,9-trimethylfluorene.
| Compound Name | 1-chloro-4-(4-phenylphenyl)benzene;3,9,9-trimethylfluorene |
|---|---|
| PubChem CID | 156827027 |
| Molecular Formula | C34H29Cl |
| Molecular Weight | 473.06 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 1-chloro-4-(4-phenylphenyl)benzene;3,9,9-trimethylfluorene |
| SMILES | Cc1ccc2c(c1)-c1ccccc1C2(C)C.Clc1ccc(-c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C18H13Cl.C16H16/c19-18-12-10-17(11-13-18)16-8-6-15(7-9-16)14-4-2-1-3-5-14;1-11-8-9-15-13(10-11)12-6-4-5-7-14(12)16(15,2)3/h1-13H;4-10H,1-3H3 |
| InChIKey | XMKDEJAPCNQEJC-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.06 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |