About 2-[(E)-4-chlorobut-1-enyl]aniline;ethenamine
2-[(E)-4-chlorobut-1-enyl]aniline;ethenamine (PubChem CID 144811193) has the molecular formula C12H17ClN2
and a molecular weight of 224.74 g/mol. Its IUPAC name is 2-[(E)-4-chlorobut-1-enyl]aniline;ethenamine.
Molecular Properties
| Compound Name | 2-[(E)-4-chlorobut-1-enyl]aniline;ethenamine |
| PubChem CID | 144811193 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.74 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-[(E)-4-chlorobut-1-enyl]aniline;ethenamine |
| SMILES | C=CN.Nc1ccccc1/C=C/CCCl |
| InChI | InChI=1S/C10H12ClN.C2H5N/c11-8-4-3-6-9-5-1-2-7-10(9)12;1-2-3/h1-3,5-7H,4,8,12H2;2H,1,3H2/b6-3+; |
| InChIKey | CMZANWBLRLMYRQ-ZIKNSQGESA-N |
| XLogP | 3.00 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.74 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-4-chlorobut-1-enyl]aniline;ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-4-chlorobut-1-enyl]aniline;ethenamine?
The IUPAC name of 2-[(E)-4-chlorobut-1-enyl]aniline;ethenamine (CID 144811193) is 2-[(E)-4-chlorobut-1-enyl]aniline;ethenamine.
What is the SMILES notation for 2-[(E)-4-chlorobut-1-enyl]aniline;ethenamine?
The canonical SMILES for 2-[(E)-4-chlorobut-1-enyl]aniline;ethenamine is C=CN.Nc1ccccc1/C=C/CCCl.
What is the InChIKey of 2-[(E)-4-chlorobut-1-enyl]aniline;ethenamine?
The InChIKey is CMZANWBLRLMYRQ-ZIKNSQGESA-N. The full InChI is InChI=1S/C10H12ClN.C2H5N/c11-8-4-3-6-9-5-1-2-7-10(9)12;1-2-3/h1-3,5-7H,4,8,12H2;2H,1,3H2/b6-3+;.
What are the key properties of 2-[(E)-4-chlorobut-1-enyl]aniline;ethenamine?
2-[(E)-4-chlorobut-1-enyl]aniline;ethenamine has a molecular weight of 224.74 g/mol, XLogP of 3.00, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-4-chlorobut-1-enyl]aniline;ethenamine is sourced from PubChem (CID 144811193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).