C11H20N2 — CID 144812611
1,9-dimethyl-3,9-diazatricyclo[4.4.1.03,11]undecane (PubChem CID 144812611) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 1,9-dimethyl-3,9-diazatricyclo[4.4.1.03,11]undecane.
| Compound Name | 1,9-dimethyl-3,9-diazatricyclo[4.4.1.03,11]undecane |
|---|---|
| PubChem CID | 144812611 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1,9-dimethyl-3,9-diazatricyclo[4.4.1.03,11]undecane |
| SMILES | CN1CCC2CCN3CC(C)(C1)C23 |
| InChI | InChI=1S/C11H20N2/c1-11-7-12(2)5-3-9-4-6-13(8-11)10(9)11/h9-10H,3-8H2,1-2H3 |
| InChIKey | XDMOYJVMPKUVEN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |