C9H17NO2 — CID 21050567
6,9-dimethyl-1,4-dioxa-9-azaspiro[4.5]decane (PubChem CID 21050567) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is 6,9-dimethyl-1,4-dioxa-9-azaspiro[4.5]decane.
| Compound Name | 6,9-dimethyl-1,4-dioxa-9-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 21050567 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 6,9-dimethyl-1,4-dioxa-9-azaspiro[4.5]decane |
| SMILES | CC1CCN(C)CC12OCCO2 |
| InChI | InChI=1S/C9H17NO2/c1-8-3-4-10(2)7-9(8)11-5-6-12-9/h8H,3-7H2,1-2H3 |
| InChIKey | QYWILTJKJIJVSI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |