C7H14N2 — CID 71432744
(1S,6R)-3-methyl-3,8-diazabicyclo[4.2.0]octane (PubChem CID 71432744) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is (1S,6R)-3-methyl-3,8-diazabicyclo[4.2.0]octane.
| Compound Name | (1S,6R)-3-methyl-3,8-diazabicyclo[4.2.0]octane |
|---|---|
| PubChem CID | 71432744 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | (1S,6R)-3-methyl-3,8-diazabicyclo[4.2.0]octane |
| SMILES | CN1CC[C@@H]2CN[C@@H]2C1 |
| InChI | InChI=1S/C7H14N2/c1-9-3-2-6-4-8-7(6)5-9/h6-8H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | FKLSALOSNKEZRE-RNFRBKRXSA-N |
| XLogP | -0.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |