C14H23N3 — CID 144812667
ethane;N-ethenyl-5,5-dimethyl-1-[(E)-prop-1-enyl]-1,4-diazepin-2-imine (PubChem CID 144812667) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is ethane;N-ethenyl-5,5-dimethyl-1-[(E)-prop-1-enyl]-1,4-diazepin-2-imine.
| Compound Name | ethane;N-ethenyl-5,5-dimethyl-1-[(E)-prop-1-enyl]-1,4-diazepin-2-imine |
|---|---|
| PubChem CID | 144812667 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | ethane;N-ethenyl-5,5-dimethyl-1-[(E)-prop-1-enyl]-1,4-diazepin-2-imine |
| SMILES | C=C/N=C1\C=NC(C)(C)C=CN1/C=C/C.CC |
| InChI | InChI=1S/C12H17N3.C2H6/c1-5-8-15-9-7-12(3,4)14-10-11(15)13-6-2;1-2/h5-10H,2H2,1,3-4H3;1-2H3/b8-5+,13-11+; |
| InChIKey | UGIVGAKFCUHZCE-VVHCZRFDSA-N |
| XLogP | 3.77 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|