C15H21N — CID 144815807
2-methyl-N-[1-(2-propan-2-ylcyclohexa-1,3-dien-1-yl)ethenyl]prop-2-en-1-imine (PubChem CID 144815807) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-methyl-N-[1-(2-propan-2-ylcyclohexa-1,3-dien-1-yl)ethenyl]prop-2-en-1-imine.
| Compound Name | 2-methyl-N-[1-(2-propan-2-ylcyclohexa-1,3-dien-1-yl)ethenyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 144815807 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 2-methyl-N-[1-(2-propan-2-ylcyclohexa-1,3-dien-1-yl)ethenyl]prop-2-en-1-imine |
| SMILES | C=C(C)/C=N/C(=C)C1=C(C(C)C)C=CCC1 |
| InChI | InChI=1S/C15H21N/c1-11(2)10-16-13(5)15-9-7-6-8-14(15)12(3)4/h6,8,10,12H,1,5,7,9H2,2-4H3/b16-10+ |
| InChIKey | CFUJISVTTSSENY-MHWRWJLKSA-N |
| XLogP | 4.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|