C21H30N4S — CID 144817924
4-(2-aminoethylsulfanyl)-N-(3-methylbutyl)-6-(2-phenylcyclobutyl)pyrimidin-2-amine (PubChem CID 144817924) has the molecular formula C21H30N4S and a molecular weight of 370.57 g/mol. Its IUPAC name is 4-(2-aminoethylsulfanyl)-N-(3-methylbutyl)-6-(2-phenylcyclobutyl)pyrimidin-2-amine.
| Compound Name | 4-(2-aminoethylsulfanyl)-N-(3-methylbutyl)-6-(2-phenylcyclobutyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 144817924 |
| Molecular Formula | C21H30N4S |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 4-(2-aminoethylsulfanyl)-N-(3-methylbutyl)-6-(2-phenylcyclobutyl)pyrimidin-2-amine |
| SMILES | CC(C)CCNc1nc(SCCN)cc(C2CCC2c2ccccc2)n1 |
| InChI | InChI=1S/C21H30N4S/c1-15(2)10-12-23-21-24-19(14-20(25-21)26-13-11-22)18-9-8-17(18)16-6-4-3-5-7-16/h3-7,14-15,17-18H,8-13,22H2,1-2H3,(H,23,24,25) |
| InChIKey | QRTYMHRRHKABPZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |