C38H62N8 — CID 144818020
2-N,4-N-bis(3-methylbutyl)-6-(2-phenylcyclobutyl)pyrimidine-2,4-diamine;2-N,4-N-bis(3-methylbutyl)pyrimidine-2,4-diamine (PubChem CID 144818020) has the molecular formula C38H62N8 and a molecular weight of 630.97 g/mol. Its IUPAC name is 2-N,4-N-bis(3-methylbutyl)-6-(2-phenylcyclobutyl)pyrimidine-2,4-diamine;2-N,4-N-bis(3-methylbutyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(3-methylbutyl)-6-(2-phenylcyclobutyl)pyrimidine-2,4-diamine;2-N,4-N-bis(3-methylbutyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 144818020 |
| Molecular Formula | C38H62N8 |
| Molecular Weight | 630.97 g/mol |
| Exact Mass | 630.51 |
| IUPAC Name | 2-N,4-N-bis(3-methylbutyl)-6-(2-phenylcyclobutyl)pyrimidine-2,4-diamine;2-N,4-N-bis(3-methylbutyl)pyrimidine-2,4-diamine |
| SMILES | CC(C)CCNc1cc(C2CCC2c2ccccc2)nc(NCCC(C)C)n1.CC(C)CCNc1ccnc(NCCC(C)C)n1 |
| InChI | InChI=1S/C24H36N4.C14H26N4/c1-17(2)12-14-25-23-16-22(27-24(28-23)26-15-13-18(3)4)21-11-10-20(21)19-8-6-5-7-9-19;1-11(2)5-8-15-13-7-10-17-14(18-13)16-9-6-12(3)4/h5-9,16-18,20-21H,10-15H2,1-4H3,(H2,25,26,27,28);7,10-12H,5-6,8-9H2,1-4H3,(H2,15,16,17,18) |
| InChIKey | GQDWYYGXZYUYBB-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.97 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |