C21H32O3 — CID 144818188
methyl (Z)-7-[(1S,5E)-4-hydroxy-5-[(Z)-oct-5-enylidene]cyclopent-2-en-1-yl]hept-5-enoate (PubChem CID 144818188) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is methyl (Z)-7-[(1S,5E)-4-hydroxy-5-[(Z)-oct-5-enylidene]cyclopent-2-en-1-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1S,5E)-4-hydroxy-5-[(Z)-oct-5-enylidene]cyclopent-2-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 144818188 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | methyl (Z)-7-[(1S,5E)-4-hydroxy-5-[(Z)-oct-5-enylidene]cyclopent-2-en-1-yl]hept-5-enoate |
| SMILES | CC/C=C\CCC/C=C1/C(O)C=C[C@@H]1C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C21H32O3/c1-3-4-5-6-7-11-14-19-18(16-17-20(19)22)13-10-8-9-12-15-21(23)24-2/h4-5,8,10,14,16-18,20,22H,3,6-7,9,11-13,15H2,1-2H3/b5-4-,10-8-,19-14+/t18-,20?/m0/s1 |
| InChIKey | XUPMEMFGINGJEY-KKJLJOHMSA-N |
| XLogP | 4.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|