C27H20 — CID 144820076
spiro[3,7-dihydro-2H-benzo[a]azulene-10,10'-benzo[a]azulene] (PubChem CID 144820076) has the molecular formula C27H20 and a molecular weight of 344.46 g/mol. Its IUPAC name is spiro[3,7-dihydro-2H-benzo[a]azulene-10,10'-benzo[a]azulene].
| Compound Name | spiro[3,7-dihydro-2H-benzo[a]azulene-10,10'-benzo[a]azulene] |
|---|---|
| PubChem CID | 144820076 |
| Molecular Formula | C27H20 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | spiro[3,7-dihydro-2H-benzo[a]azulene-10,10'-benzo[a]azulene] |
| SMILES | C1=CC=C2C(=CC=1)C1(C3=CCCC=C3C3=C1C=CCC=C3)c1ccccc12 |
| InChI | InChI=1S/C27H20/c1-3-11-19-21-13-7-9-17-25(21)27(23(19)15-5-1)24-16-6-2-4-12-20(24)22-14-8-10-18-26(22)27/h3-6,8,10-18H,1,7,9H2 |
| InChIKey | XOZASIYWPXDXST-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |