C29H38N2O7 — CID 144822082
N-[(3S)-7-[(3Z)-3-ethenylhexa-3,5-dienyl]-9-methyl-2-oxo-1,5-dioxonan-3-yl]-3-hydroxy-4-methoxypyridine-2-carboxamide;(3E)-hexa-1,3,5-trien-3-ol (PubChem CID 144822082) has the molecular formula C29H38N2O7 and a molecular weight of 526.63 g/mol. Its IUPAC name is N-[(3S)-7-[(3Z)-3-ethenylhexa-3,5-dienyl]-9-methyl-2-oxo-1,5-dioxonan-3-yl]-3-hydroxy-4-methoxypyridine-2-carboxamide;(3E)-hexa-1,3,5-trien-3-ol.
| Compound Name | N-[(3S)-7-[(3Z)-3-ethenylhexa-3,5-dienyl]-9-methyl-2-oxo-1,5-dioxonan-3-yl]-3-hydroxy-4-methoxypyridine-2-carboxamide;(3E)-hexa-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 144822082 |
| Molecular Formula | C29H38N2O7 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | N-[(3S)-7-[(3Z)-3-ethenylhexa-3,5-dienyl]-9-methyl-2-oxo-1,5-dioxonan-3-yl]-3-hydroxy-4-methoxypyridine-2-carboxamide;(3E)-hexa-1,3,5-trien-3-ol |
| SMILES | C=C/C=C(/O)C=C.C=C/C=C(\C=C)CCC1COC[C@H](NC(=O)c2nccc(OC)c2O)C(=O)OC(C)C1 |
| InChI | InChI=1S/C23H30N2O6.C6H8O/c1-5-7-16(6-2)8-9-17-12-15(3)31-23(28)18(14-30-13-17)25-22(27)20-21(26)19(29-4)10-11-24-20;1-3-5-6(7)4-2/h5-7,10-11,15,17-18,26H,1-2,8-9,12-14H2,3-4H3,(H,25,27);3-5,7H,1-2H2/b16-7+;6-5+/t15?,17?,18-;/m0./s1 |
| InChIKey | MPDWGQRBXWDIGR-XXWLHTPSSA-N |
| XLogP | 4.74 |
| TPSA | 127.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|