About 4-acetamido-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)benzamide;molecular hydrogen
4-acetamido-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)benzamide;molecular hydrogen (PubChem CID 144822336) has the molecular formula C21H25N3O2S
and a molecular weight of 383.52 g/mol. Its IUPAC name is 4-acetamido-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)benzamide;molecular hydrogen.
Molecular Properties
| Compound Name | 4-acetamido-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)benzamide;molecular hydrogen |
| PubChem CID | 144822336 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 4-acetamido-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)benzamide;molecular hydrogen |
| SMILES | CC(=O)Nc1ccc(C(=O)Nc2nc(-c3ccccc3)c(C(C)C)s2)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C21H21N3O2S.2H2/c1-13(2)19-18(15-7-5-4-6-8-15)23-21(27-19)24-20(26)16-9-11-17(12-10-16)22-14(3)25;;/h4-13H,1-3H3,(H,22,25)(H,23,24,26);2*1H |
| InChIKey | TVDLYXISOBDJKD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-acetamido-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)benzamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetamido-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)benzamide;molecular hydrogen?
The IUPAC name of 4-acetamido-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)benzamide;molecular hydrogen (CID 144822336) is 4-acetamido-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)benzamide;molecular hydrogen.
What is the SMILES notation for 4-acetamido-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)benzamide;molecular hydrogen?
The canonical SMILES for 4-acetamido-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)benzamide;molecular hydrogen is CC(=O)Nc1ccc(C(=O)Nc2nc(-c3ccccc3)c(C(C)C)s2)cc1.[H][H].[H][H].
What is the InChIKey of 4-acetamido-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)benzamide;molecular hydrogen?
The InChIKey is TVDLYXISOBDJKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O2S.2H2/c1-13(2)19-18(15-7-5-4-6-8-15)23-21(27-19)24-20(26)16-9-11-17(12-10-16)22-14(3)25;;/h4-13H,1-3H3,(H,22,25)(H,23,24,26);2*1H.
What are the key properties of 4-acetamido-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)benzamide;molecular hydrogen?
4-acetamido-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)benzamide;molecular hydrogen has a molecular weight of 383.52 g/mol, XLogP of 5.64, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetamido-N-(4-phenyl-5-propan-2-yl-1,3-thiazol-2-yl)benzamide;molecular hydrogen is sourced from PubChem (CID 144822336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).