About [(1Z,2R,4S)-4-hydroxy-1-hydroxyiminohex-5-en-2-yl] 4-phenylbenzoate
[(1Z,2R,4S)-4-hydroxy-1-hydroxyiminohex-5-en-2-yl] 4-phenylbenzoate (PubChem CID 144825937) has the molecular formula C19H19NO4
and a molecular weight of 325.36 g/mol. Its IUPAC name is [(1Z,2R,4S)-4-hydroxy-1-hydroxyiminohex-5-en-2-yl] 4-phenylbenzoate.
Molecular Properties
| Compound Name | [(1Z,2R,4S)-4-hydroxy-1-hydroxyiminohex-5-en-2-yl] 4-phenylbenzoate |
| PubChem CID | 144825937 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [(1Z,2R,4S)-4-hydroxy-1-hydroxyiminohex-5-en-2-yl] 4-phenylbenzoate |
| SMILES | C=C[C@@H](O)C[C@H](/C=N\O)OC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19NO4/c1-2-17(21)12-18(13-20-23)24-19(22)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h2-11,13,17-18,21,23H,1,12H2/b20-13-/t17-,18-/m1/s1 |
| InChIKey | OEFUHXPYOKHVSX-WDMUNCKQSA-N |
| XLogP | 3.28 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1Z,2R,4S)-4-hydroxy-1-hydroxyiminohex-5-en-2-yl] 4-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1Z,2R,4S)-4-hydroxy-1-hydroxyiminohex-5-en-2-yl] 4-phenylbenzoate?
The IUPAC name of [(1Z,2R,4S)-4-hydroxy-1-hydroxyiminohex-5-en-2-yl] 4-phenylbenzoate (CID 144825937) is [(1Z,2R,4S)-4-hydroxy-1-hydroxyiminohex-5-en-2-yl] 4-phenylbenzoate.
What is the SMILES notation for [(1Z,2R,4S)-4-hydroxy-1-hydroxyiminohex-5-en-2-yl] 4-phenylbenzoate?
The canonical SMILES for [(1Z,2R,4S)-4-hydroxy-1-hydroxyiminohex-5-en-2-yl] 4-phenylbenzoate is C=C[C@@H](O)C[C@H](/C=N\O)OC(=O)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of [(1Z,2R,4S)-4-hydroxy-1-hydroxyiminohex-5-en-2-yl] 4-phenylbenzoate?
The InChIKey is OEFUHXPYOKHVSX-WDMUNCKQSA-N. The full InChI is InChI=1S/C19H19NO4/c1-2-17(21)12-18(13-20-23)24-19(22)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h2-11,13,17-18,21,23H,1,12H2/b20-13-/t17-,18-/m1/s1.
What are the key properties of [(1Z,2R,4S)-4-hydroxy-1-hydroxyiminohex-5-en-2-yl] 4-phenylbenzoate?
[(1Z,2R,4S)-4-hydroxy-1-hydroxyiminohex-5-en-2-yl] 4-phenylbenzoate has a molecular weight of 325.36 g/mol, XLogP of 3.28, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1Z,2R,4S)-4-hydroxy-1-hydroxyiminohex-5-en-2-yl] 4-phenylbenzoate is sourced from PubChem (CID 144825937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).