C19H19NO4 — CID 144825937
[(1Z,2R,4S)-4-hydroxy-1-hydroxyiminohex-5-en-2-yl] 4-phenylbenzoate (PubChem CID 144825937) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is [(1Z,2R,4S)-4-hydroxy-1-hydroxyiminohex-5-en-2-yl] 4-phenylbenzoate.
| Compound Name | [(1Z,2R,4S)-4-hydroxy-1-hydroxyiminohex-5-en-2-yl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 144825937 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [(1Z,2R,4S)-4-hydroxy-1-hydroxyiminohex-5-en-2-yl] 4-phenylbenzoate |
| SMILES | C=C[C@@H](O)C[C@H](/C=N\O)OC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19NO4/c1-2-17(21)12-18(13-20-23)24-19(22)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h2-11,13,17-18,21,23H,1,12H2/b20-13-/t17-,18-/m1/s1 |
| InChIKey | OEFUHXPYOKHVSX-WDMUNCKQSA-N |
| XLogP | 3.28 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|