About 4-fluorobenzenesulfinyl chloride;methyl 4-methylazetidine-2-carboxylate
4-fluorobenzenesulfinyl chloride;methyl 4-methylazetidine-2-carboxylate (PubChem CID 144826309) has the molecular formula C12H15ClFNO3S
and a molecular weight of 307.77 g/mol. Its IUPAC name is 4-fluorobenzenesulfinyl chloride;methyl 4-methylazetidine-2-carboxylate.
Molecular Properties
| Compound Name | 4-fluorobenzenesulfinyl chloride;methyl 4-methylazetidine-2-carboxylate |
| PubChem CID | 144826309 |
| Molecular Formula | C12H15ClFNO3S |
| Molecular Weight | 307.77 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 4-fluorobenzenesulfinyl chloride;methyl 4-methylazetidine-2-carboxylate |
| SMILES | COC(=O)C1CC(C)N1.O=S(Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C6H4ClFOS.C6H11NO2/c7-10(9)6-3-1-5(8)2-4-6;1-4-3-5(7-4)6(8)9-2/h1-4H;4-5,7H,3H2,1-2H3 |
| InChIKey | ZQMYSOODTQXIJX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.77 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-fluorobenzenesulfinyl chloride;methyl 4-methylazetidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorobenzenesulfinyl chloride;methyl 4-methylazetidine-2-carboxylate?
The IUPAC name of 4-fluorobenzenesulfinyl chloride;methyl 4-methylazetidine-2-carboxylate (CID 144826309) is 4-fluorobenzenesulfinyl chloride;methyl 4-methylazetidine-2-carboxylate.
What is the SMILES notation for 4-fluorobenzenesulfinyl chloride;methyl 4-methylazetidine-2-carboxylate?
The canonical SMILES for 4-fluorobenzenesulfinyl chloride;methyl 4-methylazetidine-2-carboxylate is COC(=O)C1CC(C)N1.O=S(Cl)c1ccc(F)cc1.
What is the InChIKey of 4-fluorobenzenesulfinyl chloride;methyl 4-methylazetidine-2-carboxylate?
The InChIKey is ZQMYSOODTQXIJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClFOS.C6H11NO2/c7-10(9)6-3-1-5(8)2-4-6;1-4-3-5(7-4)6(8)9-2/h1-4H;4-5,7H,3H2,1-2H3.
What are the key properties of 4-fluorobenzenesulfinyl chloride;methyl 4-methylazetidine-2-carboxylate?
4-fluorobenzenesulfinyl chloride;methyl 4-methylazetidine-2-carboxylate has a molecular weight of 307.77 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorobenzenesulfinyl chloride;methyl 4-methylazetidine-2-carboxylate is sourced from PubChem (CID 144826309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).