C18H33FNO13P — CID 144828973
[(2S,3R)-3-[bis(propan-2-yloxycarbonyloxymethoxy)phosphoryloxymethyl]-4-fluoro-3-methoxybutan-2-yl] 2-aminoacetate (PubChem CID 144828973) has the molecular formula C18H33FNO13P and a molecular weight of 521.43 g/mol. Its IUPAC name is [(2S,3R)-3-[bis(propan-2-yloxycarbonyloxymethoxy)phosphoryloxymethyl]-4-fluoro-3-methoxybutan-2-yl] 2-aminoacetate.
| Compound Name | [(2S,3R)-3-[bis(propan-2-yloxycarbonyloxymethoxy)phosphoryloxymethyl]-4-fluoro-3-methoxybutan-2-yl] 2-aminoacetate |
|---|---|
| PubChem CID | 144828973 |
| Molecular Formula | C18H33FNO13P |
| Molecular Weight | 521.43 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | [(2S,3R)-3-[bis(propan-2-yloxycarbonyloxymethoxy)phosphoryloxymethyl]-4-fluoro-3-methoxybutan-2-yl] 2-aminoacetate |
| SMILES | CO[C@](CF)(COP(=O)(OCOC(=O)OC(C)C)OCOC(=O)OC(C)C)[C@H](C)OC(=O)CN |
| InChI | InChI=1S/C18H33FNO13P/c1-12(2)31-16(22)26-10-29-34(24,30-11-27-17(23)32-13(3)4)28-9-18(8-19,25-6)14(5)33-15(21)7-20/h12-14H,7-11,20H2,1-6H3/t14-,18+/m0/s1 |
| InChIKey | GENXQYICGBBRTH-KBXCAEBGSA-N |
| XLogP | 2.43 |
| TPSA | 177.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|