C26H38FN4O9P — CID 144829068
cyclohexyl 2-[[[(3R,4R,5R)-2-(aminomethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-5-methoxypentoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 144829068) has the molecular formula C26H38FN4O9P and a molecular weight of 600.58 g/mol. Its IUPAC name is cyclohexyl 2-[[[(3R,4R,5R)-2-(aminomethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-5-methoxypentoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl 2-[[[(3R,4R,5R)-2-(aminomethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-5-methoxypentoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 144829068 |
| Molecular Formula | C26H38FN4O9P |
| Molecular Weight | 600.58 g/mol |
| Exact Mass | 600.24 |
| IUPAC Name | cyclohexyl 2-[[[(3R,4R,5R)-2-(aminomethyl)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-5-methoxypentoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | CO[C@H]([C@H](F)[C@H](O)C(CN)COP(=O)(NC(C)C(=O)OC1CCCCC1)Oc1ccccc1)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C26H38FN4O9P/c1-17(25(34)39-19-9-5-3-6-10-19)30-41(36,40-20-11-7-4-8-12-20)38-16-18(15-28)23(33)22(27)24(37-2)31-14-13-21(32)29-26(31)35/h4,7-8,11-14,17-19,22-24,33H,3,5-6,9-10,15-16,28H2,1-2H3,(H,30,36)(H,29,32,35)/t17?,18?,22-,23-,24-,41?/m1/s1 |
| InChIKey | AGPGWZFVKYIXRP-BAXWZZJESA-N |
| XLogP | 2.01 |
| TPSA | 184.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.58 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|