About acetylene;N-[2-(5-bromo-3-chloro-2-pyridinyl)ethyl]formamide;ethane
acetylene;N-[2-(5-bromo-3-chloro-2-pyridinyl)ethyl]formamide;ethane (PubChem CID 144829700) has the molecular formula C12H16BrClN2O
and a molecular weight of 319.63 g/mol. Its IUPAC name is acetylene;N-[2-(5-bromo-3-chloro-2-pyridinyl)ethyl]formamide;ethane.
Molecular Properties
| Compound Name | acetylene;N-[2-(5-bromo-3-chloro-2-pyridinyl)ethyl]formamide;ethane |
| PubChem CID | 144829700 |
| Molecular Formula | C12H16BrClN2O |
| Molecular Weight | 319.63 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | acetylene;N-[2-(5-bromo-3-chloro-2-pyridinyl)ethyl]formamide;ethane |
| SMILES | C#C.CC.O=CNCCc1ncc(Br)cc1Cl |
| InChI | InChI=1S/C8H8BrClN2O.C2H6.C2H2/c9-6-3-7(10)8(12-4-6)1-2-11-5-13;2*1-2/h3-5H,1-2H2,(H,11,13);1-2H3;1-2H |
| InChIKey | ONTDVFBXKJWYBI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.63 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;N-[2-(5-bromo-3-chloro-2-pyridinyl)ethyl]formamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;N-[2-(5-bromo-3-chloro-2-pyridinyl)ethyl]formamide;ethane?
The IUPAC name of acetylene;N-[2-(5-bromo-3-chloro-2-pyridinyl)ethyl]formamide;ethane (CID 144829700) is acetylene;N-[2-(5-bromo-3-chloro-2-pyridinyl)ethyl]formamide;ethane.
What is the SMILES notation for acetylene;N-[2-(5-bromo-3-chloro-2-pyridinyl)ethyl]formamide;ethane?
The canonical SMILES for acetylene;N-[2-(5-bromo-3-chloro-2-pyridinyl)ethyl]formamide;ethane is C#C.CC.O=CNCCc1ncc(Br)cc1Cl.
What is the InChIKey of acetylene;N-[2-(5-bromo-3-chloro-2-pyridinyl)ethyl]formamide;ethane?
The InChIKey is ONTDVFBXKJWYBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrClN2O.C2H6.C2H2/c9-6-3-7(10)8(12-4-6)1-2-11-5-13;2*1-2/h3-5H,1-2H2,(H,11,13);1-2H3;1-2H.
What are the key properties of acetylene;N-[2-(5-bromo-3-chloro-2-pyridinyl)ethyl]formamide;ethane?
acetylene;N-[2-(5-bromo-3-chloro-2-pyridinyl)ethyl]formamide;ethane has a molecular weight of 319.63 g/mol, XLogP of 3.06, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;N-[2-(5-bromo-3-chloro-2-pyridinyl)ethyl]formamide;ethane is sourced from PubChem (CID 144829700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).