C9H15NO — CID 144830408
(3Z)-4-amino-5-methylhexa-1,3,5-trien-3-ol;ethene (PubChem CID 144830408) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (3Z)-4-amino-5-methylhexa-1,3,5-trien-3-ol;ethene.
| Compound Name | (3Z)-4-amino-5-methylhexa-1,3,5-trien-3-ol;ethene |
|---|---|
| PubChem CID | 144830408 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (3Z)-4-amino-5-methylhexa-1,3,5-trien-3-ol;ethene |
| SMILES | C=C.C=C/C(O)=C(/N)C(=C)C |
| InChI | InChI=1S/C7H11NO.C2H4/c1-4-6(9)7(8)5(2)3;1-2/h4,9H,1-2,8H2,3H3;1-2H2/b7-6-; |
| InChIKey | URGNQWSXRXYRSV-NAFXZHHSSA-N |
| XLogP | 2.28 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|