C20H24FN3O4 — CID 144830519
N-[2-[3-[(5-fluoro-6-phenylmethoxypyrimidin-4-yl)oxymethyl]cyclobutyl]oxyethyl]acetamide (PubChem CID 144830519) has the molecular formula C20H24FN3O4 and a molecular weight of 389.43 g/mol. Its IUPAC name is N-[2-[3-[(5-fluoro-6-phenylmethoxypyrimidin-4-yl)oxymethyl]cyclobutyl]oxyethyl]acetamide.
| Compound Name | N-[2-[3-[(5-fluoro-6-phenylmethoxypyrimidin-4-yl)oxymethyl]cyclobutyl]oxyethyl]acetamide |
|---|---|
| PubChem CID | 144830519 |
| Molecular Formula | C20H24FN3O4 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | N-[2-[3-[(5-fluoro-6-phenylmethoxypyrimidin-4-yl)oxymethyl]cyclobutyl]oxyethyl]acetamide |
| SMILES | CC(=O)NCCOC1CC(COc2ncnc(OCc3ccccc3)c2F)C1 |
| InChI | InChI=1S/C20H24FN3O4/c1-14(25)22-7-8-26-17-9-16(10-17)12-28-20-18(21)19(23-13-24-20)27-11-15-5-3-2-4-6-15/h2-6,13,16-17H,7-12H2,1H3,(H,22,25) |
| InChIKey | HNTXTSHNFVELIW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|