C10H17NO6 — CID 14483137
(3aR,5R,6S,6aR)-5-[(E)-C-(hydroxymethyl)-N-methoxycarbonimidoyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 14483137) has the molecular formula C10H17NO6 and a molecular weight of 247.25 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-[(E)-C-(hydroxymethyl)-N-methoxycarbonimidoyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,5R,6S,6aR)-5-[(E)-C-(hydroxymethyl)-N-methoxycarbonimidoyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 14483137 |
| Molecular Formula | C10H17NO6 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-[(E)-C-(hydroxymethyl)-N-methoxycarbonimidoyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | CO/N=C(\CO)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1O |
| InChI | InChI=1S/C10H17NO6/c1-10(2)16-8-6(13)7(15-9(8)17-10)5(4-12)11-14-3/h6-9,12-13H,4H2,1-3H3/b11-5+/t6-,7+,8+,9+/m0/s1 |
| InChIKey | VWEIBAHMVSECDQ-YUEKCPPJSA-N |
| XLogP | -0.78 |
| TPSA | 89.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|